Difluoroacetic acid

Difluoroacetic acid

Names
IUPAC name 2,2-Difluoroacetic acid
Identifiers
CAS Number	381-73-7
3D model (JSmol)	Interactive image
ChemSpider	10200426
PubChem CID	9788
InChI InChI=1S/C2H2F2O2/c3-1(4)2(5)6/h1H,(H,5,6) Key: PBWZKZYHONABLN-UHFFFAOYSA-N
SMILES C(C(=O)O)(F)F
Properties
Chemical formula	C2H2F2O2
Molar mass	96.03 g·mol−1
Density	1.526 g/mL
Melting point	−1 °C (30 °F; 272 K)
Boiling point	132–134 °C (270–273 °F; 405–407 K)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Difluoroacetic acid is a chemical compound with formula CHF₂COOH. It is a dihalogenocarboxylic acid, specifically a structural analog of acetic acid with two of three hydrogen atoms on the alpha carbon replaced with fluorine atoms. In solution, it dissociates to form difluoroacetate ions. Difluoroacetic acid can also be used as direct C-H difluoromethylating reagent..