Herniarin

Herniarin

Names
IUPAC name 7-Methoxychromen-2-one
Other names 7-O-Methylumbelliferone 7-Methoxycoumarin Ayapanin Herniarine Methyl umbelliferyl ether
Identifiers
CAS Number	531-59-9 Y=
3D model (JSmol)	Interactive image
ChemSpider	10295 N
ECHA InfoCard	100.007.741
PubChem CID	10748
InChI InChI=1S/C10H8O3/c1-12-8-4-2-7-3-5-10(11)13-9(7)6-8/h2-6H,1H3 N Key: LIIALPBMIOVAHH-UHFFFAOYSA-N N InChI=1/C10H8O3/c1-12-8-4-2-7-3-5-10(11)13-9(7)6-8/h2-6H,1H3 Key: LIIALPBMIOVAHH-UHFFFAOYAW
SMILES O=C/2Oc1cc(OC)ccc1\C=C\2
Properties
Chemical formula	C10H8O3
Molar mass	176.17 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Herniarin is a natural chemical compound. Chemically, it can be considered a methoxy derivative of coumarin or a methyl derivative of umbelliferone.

Herniarin is found in Herniaria glabra,Ayapana triplinervis and in species of the genus Prunus (P. mahaleb, P. pensylvanica, and P. maximowiczii).