Scillavone B

Scillavone B
Identifiers

CAS Number	1105671-01-9
3D model (JSmol)	Interactive image
ChemSpider	32077067
InChI InChI=1S/C18H18O7/c1-23-14-7-13-15(17(22)18(14)24-2)16(21)10(8-25-13)5-9-3-4-11(19)12(20)6-9/h3-4,6-7,10,19-20,22H,5,8H2,1-2H3/t10-/m0/s1 Key: IWDPSYVRXCJSRF-JTQLQIEISA-N
SMILES COc1cc2c(c(c1OC)O)C(=O)[C@H](CO2)Cc3ccc(c(c3)O)O
Properties
Chemical formula	C₁₈H₁₈O₇
Molar mass	346.33 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Scillavone B is a homoisoflavone that can be isolated from the bulbs of Scilla scilloides (Barnardia japonica).