| Zoisite | |
|---|---|
|
Yellow zoisite crystal (1.7 x 1 x 0.8 cm)
|
|
| General | |
| Category | Sorosilicate - epidote group |
|
Formula (repeating unit) |
Ca2Al3(SiO4)(Si2O7)O(OH) |
| Strunz classification | 9.BG.10 |
| Dana classification | 58.2.1b.1 |
| Crystal system | Orthorhombic |
| Crystal class | Dipyramidal (mmm) H-M symbol: (2/m 2/m 2/m) |
| Space group | Pnma |
| Identification | |
| Color | White, gray, greenish brown, greenish gray, pink, blue, purple |
| Crystal habit | Prismatic crystals with striations; massive to columnar |
| Cleavage | Perfect {010} imperfect {100} |
| Fracture | Uneven to conchoidal |
| Mohs scale hardness | 6 to 7 |
| Luster | Vitreous, pearly on cleavage surfaces |
| Streak | White or colorless |
| Diaphaneity | Transparent to translucent |
| Specific gravity | 3.10–3.36 |
| Optical properties | biaxial positive |
| Refractive index | nα = 1.696 - 1.700 nβ = 1.696 - 1.702 nγ = 1.702 - 1.718 |
| Birefringence | 0.006-0.018 |
| Pleochroism | X = pale pink to red-violet; Y = nearly colorless to bright pink or deep blue; Z = pale yellow to yellow-green |
| References | |
| Major varieties | |
| Tanzanite | Gem-quality zoisite, blue-purple |
| Thulite | Pink |
Zoisite, first known as saualpite, after its type locality, is a calcium aluminium hydroxy sorosilicate belonging to the epidote group of minerals. Its chemical formula is Ca2Al3(SiO4)(Si2O7)O(OH).
Zoisite occurs as prismatic, orthorhombic (2/m 2/m 2/m) crystals or in massive form, being found in metamorphic and pegmatitic rock. Zoisite may be blue to violet, green, brown, pink, yellow, gray, or colorless. It has a vitreous luster and a conchoidal to uneven fracture. When euhedral, zoisite crystals are striated parallel to the principal axis (c-axis). Also parallel to the principal axis is one direction of perfect cleavage. The mineral is somewhat higher than 6 in hardness, and its specific gravity ranges from 3.10 to 3.38, depending on the variety. It streaks white and is said to be brittle. Clinozoisite is a more common monoclinic polymorph of Ca2Al3(SiO4)(Si2O7)O(OH).
Transparent material is fashioned into gemstones while translucent-to-opaque material is usually carved. A metamorphic rock known as anyolite consists of green zoisite with black tschermakite and ruby crystals. These rubies themselves are not of gem quality, but nevertheless their color provides a striking contrast to the green zoisite, and greatly enhances the decorative pieces that are carved from the rock.